C28H35N4O4S- — CID 18173840
tert-butyl N-[2-[4-[[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]phenyl]ethyl]carbamate formate (PubChem CID 18173840) has the molecular formula C28H35N4O4S- and a molecular weight of 523.68 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]phenyl]ethyl]carbamate formate.
| Compound Name | tert-butyl N-[2-[4-[[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]phenyl]ethyl]carbamate formate |
|---|---|
| PubChem CID | 18173840 |
| Molecular Formula | C28H35N4O4S- |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | tert-butyl N-[2-[4-[[1-(4-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]phenyl]ethyl]carbamate formate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(NC2CCN(c3nc(-c4ccccc4)cs3)CC2)cc1.O=C[O-] |
| InChI | InChI=1S/C27H34N4O2S.CH2O2/c1-27(2,3)33-26(32)28-16-13-20-9-11-22(12-10-20)29-23-14-17-31(18-15-23)25-30-24(19-34-25)21-7-5-4-6-8-21;2-1-3/h4-12,19,23,29H,13-18H2,1-3H3,(H,28,32);1H,(H,2,3)/p-1 |
| InChIKey | RPPRVJVAMSCQSN-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|