About tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate
tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate (PubChem CID 18173596) has the molecular formula C25H40N4O3
and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate |
| PubChem CID | 18173596 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(NC2CCN(C(=O)NCC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H40N4O3/c1-25(2,3)32-24(31)26-15-12-19-8-10-21(11-9-19)28-22-13-16-29(17-14-22)23(30)27-18-20-6-4-5-7-20/h8-11,20,22,28H,4-7,12-18H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | WNCMROGPCCPFMJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate (CID 18173596) is tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate is CC(C)(C)OC(=O)NCCc1ccc(NC2CCN(C(=O)NCC3CCCC3)CC2)cc1.
What is the InChIKey of tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate?
The InChIKey is WNCMROGPCCPFMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40N4O3/c1-25(2,3)32-24(31)26-15-12-19-8-10-21(11-9-19)28-22-13-16-29(17-14-22)23(30)27-18-20-6-4-5-7-20/h8-11,20,22,28H,4-7,12-18H2,1-3H3,(H,26,31)(H,27,30).
What are the key properties of tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate?
tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate has a molecular weight of 444.62 g/mol, XLogP of 4.53, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-[[1-(cyclopentylmethylcarbamoyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate is sourced from PubChem (CID 18173596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).