C27H34N4O3 — CID 18173857
tert-butyl N-[2-[4-[[1-(1H-indole-3-carbonyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate (PubChem CID 18173857) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[1-(1H-indole-3-carbonyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[1-(1H-indole-3-carbonyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 18173857 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | tert-butyl N-[2-[4-[[1-(1H-indole-3-carbonyl)piperidin-4-yl]amino]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(NC2CCN(C(=O)c3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C27H34N4O3/c1-27(2,3)34-26(33)28-15-12-19-8-10-20(11-9-19)30-21-13-16-31(17-14-21)25(32)23-18-29-24-7-5-4-6-22(23)24/h4-11,18,21,29-30H,12-17H2,1-3H3,(H,28,33) |
| InChIKey | JNBKALZYYJOQMN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |