C19H31N5O2 — CID 18173951
4-[4-(2-aminoethyl)anilino]-N-[3-(dimethylamino)-3-oxopropyl]piperidine-1-carboxamide (PubChem CID 18173951) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)anilino]-N-[3-(dimethylamino)-3-oxopropyl]piperidine-1-carboxamide.
| Compound Name | 4-[4-(2-aminoethyl)anilino]-N-[3-(dimethylamino)-3-oxopropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 18173951 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 4-[4-(2-aminoethyl)anilino]-N-[3-(dimethylamino)-3-oxopropyl]piperidine-1-carboxamide |
| SMILES | CN(C)C(=O)CCNC(=O)N1CCC(Nc2ccc(CCN)cc2)CC1 |
| InChI | InChI=1S/C19H31N5O2/c1-23(2)18(25)8-12-21-19(26)24-13-9-17(10-14-24)22-16-5-3-15(4-6-16)7-11-20/h3-6,17,22H,7-14,20H2,1-2H3,(H,21,26) |
| InChIKey | QTNOZDDUZJHJAO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |