C35H37FN2O5S — CID 174212713
5-(3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)-2-fluorobenzoic acid (PubChem CID 174212713) has the molecular formula C35H37FN2O5S and a molecular weight of 616.76 g/mol. Its IUPAC name is 5-(3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)-2-fluorobenzoic acid.
| Compound Name | 5-(3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 174212713 |
| Molecular Formula | C35H37FN2O5S |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 5-(3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl)-2-fluorobenzoic acid |
| SMILES | CN1C(C2CCCCC2)CN(c2ccccc2)c2cc(OCc3ccccc3)c(-c3ccc(F)c(C(=O)O)c3)cc2S1(O)O |
| InChI | InChI=1S/C35H37FN2O5S/c1-37-32(25-13-7-3-8-14-25)22-38(27-15-9-4-10-16-27)31-21-33(43-23-24-11-5-2-6-12-24)28(20-34(31)44(37,41)42)26-17-18-30(36)29(19-26)35(39)40/h2,4-6,9-12,15-21,25,32,41-42H,3,7-8,13-14,22-23H2,1H3,(H,39,40) |
| InChIKey | MFFGWVFAAWIFIA-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |