C33H33FN2O5S2 — CID 171450714
5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid (PubChem CID 171450714) has the molecular formula C33H33FN2O5S2 and a molecular weight of 620.77 g/mol. Its IUPAC name is 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid.
| Compound Name | 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 171450714 |
| Molecular Formula | C33H33FN2O5S2 |
| Molecular Weight | 620.77 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-phenylmethoxy-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(OCc3ccccc3)c(-c3cc(F)c(C(=O)O)s3)cc2S1(=O)=O |
| InChI | InChI=1S/C33H33FN2O5S2/c1-35-28(23-13-7-3-8-14-23)20-36(24-15-9-4-10-16-24)27-19-29(41-21-22-11-5-2-6-12-22)25(17-31(27)43(35,39)40)30-18-26(34)32(42-30)33(37)38/h2,4-6,9-12,15-19,23,28H,3,7-8,13-14,20-21H2,1H3,(H,37,38)/t28-/m0/s1 |
| InChIKey | NZASRYDVHGJGKX-NDEPHWFRSA-N |
| XLogP | 7.55 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.77 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |