C34H43N3O8S2 — CID 170964206
5-[(3R)-3-cyclohexyl-7-(2-methoxyethoxy)-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(2-methylpropoxycarbonylamino)thiophene-2-carboxylic acid (PubChem CID 170964206) has the molecular formula C34H43N3O8S2 and a molecular weight of 685.87 g/mol. Its IUPAC name is 5-[(3R)-3-cyclohexyl-7-(2-methoxyethoxy)-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(2-methylpropoxycarbonylamino)thiophene-2-carboxylic acid.
| Compound Name | 5-[(3R)-3-cyclohexyl-7-(2-methoxyethoxy)-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(2-methylpropoxycarbonylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170964206 |
| Molecular Formula | C34H43N3O8S2 |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | 5-[(3R)-3-cyclohexyl-7-(2-methoxyethoxy)-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(2-methylpropoxycarbonylamino)thiophene-2-carboxylic acid |
| SMILES | COCCOc1cc2c(cc1-c1cc(NC(=O)OCC(C)C)c(C(=O)O)s1)S(=O)(=O)N(C)[C@H](C1CCCCC1)CN2c1ccccc1 |
| InChI | InChI=1S/C34H43N3O8S2/c1-22(2)21-45-34(40)35-26-18-30(46-32(26)33(38)39)25-17-31-27(19-29(25)44-16-15-43-4)37(24-13-9-6-10-14-24)20-28(36(3)47(31,41)42)23-11-7-5-8-12-23/h6,9-10,13-14,17-19,22-23,28H,5,7-8,11-12,15-16,20-21H2,1-4H3,(H,35,40)(H,38,39)/t28-/m0/s1 |
| InChIKey | NEGWHJMMEDPKGN-NDEPHWFRSA-N |
| XLogP | 7.06 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|