C29H33F3N2O5S2 — CID 174207387
5-[3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid (PubChem CID 174207387) has the molecular formula C29H33F3N2O5S2 and a molecular weight of 610.72 g/mol. Its IUPAC name is 5-[3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 174207387 |
| Molecular Formula | C29H33F3N2O5S2 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | 5-[3-cyclohexyl-1,1-dihydroxy-2-methyl-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ4,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(-c2cc3c(cc2OCC(F)(F)F)N(c2ccccc2)CC(C2CCCCC2)N(C)S3(O)O)sc1C(=O)O |
| InChI | InChI=1S/C29H33F3N2O5S2/c1-18-13-25(40-27(18)28(35)36)21-14-26-22(15-24(21)39-17-29(30,31)32)34(20-11-7-4-8-12-20)16-23(33(2)41(26,37)38)19-9-5-3-6-10-19/h4,7-8,11-15,19,23,37-38H,3,5-6,9-10,16-17H2,1-2H3,(H,35,36) |
| InChIKey | GLLCHUVOTXSEBS-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |