C30H33F3N2O5S2 — CID 170964340
methyl 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylate (PubChem CID 170964340) has the molecular formula C30H33F3N2O5S2 and a molecular weight of 622.73 g/mol. Its IUPAC name is methyl 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 170964340 |
| Molecular Formula | C30H33F3N2O5S2 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | methyl 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2,2,2-trifluoroethoxy)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2cc3c(cc2OCC(F)(F)F)N(c2ccccc2)C[C@@H](C2CCCCC2)N(C)S3(=O)=O)cc1C |
| InChI | InChI=1S/C30H33F3N2O5S2/c1-19-14-26(41-28(19)29(36)39-3)22-15-27-23(16-25(22)40-18-30(31,32)33)35(21-12-8-5-9-13-21)17-24(34(2)42(27,37)38)20-10-6-4-7-11-20/h5,8-9,12-16,20,24H,4,6-7,10-11,17-18H2,1-3H3/t24-/m0/s1 |
| InChIKey | YLOFADBWDFNBOA-DEOSSOPVSA-N |
| XLogP | 7.17 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |