C32H37FN2O5S2 — CID 170963774
5-[(3R)-3-cyclohexyl-7-(3,3-dimethylcyclobutyl)oxy-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid (PubChem CID 170963774) has the molecular formula C32H37FN2O5S2 and a molecular weight of 612.79 g/mol. Its IUPAC name is 5-[(3R)-3-cyclohexyl-7-(3,3-dimethylcyclobutyl)oxy-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid.
| Compound Name | 5-[(3R)-3-cyclohexyl-7-(3,3-dimethylcyclobutyl)oxy-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170963774 |
| Molecular Formula | C32H37FN2O5S2 |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 5-[(3R)-3-cyclohexyl-7-(3,3-dimethylcyclobutyl)oxy-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-fluorothiophene-2-carboxylic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(OC3CC(C)(C)C3)c(-c3cc(F)c(C(=O)O)s3)cc2S1(=O)=O |
| InChI | InChI=1S/C32H37FN2O5S2/c1-32(2)17-22(18-32)40-27-16-25-29(14-23(27)28-15-24(33)30(41-28)31(36)37)42(38,39)34(3)26(20-10-6-4-7-11-20)19-35(25)21-12-8-5-9-13-21/h5,8-9,12-16,20,22,26H,4,6-7,10-11,17-19H2,1-3H3,(H,36,37)/t26-/m0/s1 |
| InChIKey | BQBFLNIDWOMILM-SANMLTNESA-N |
| XLogP | 7.54 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |