C29H34ClN3O6S3 — CID 170963521
5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(propylsulfonylamino)thiophene-2-carboxylic acid (PubChem CID 170963521) has the molecular formula C29H34ClN3O6S3 and a molecular weight of 652.26 g/mol. Its IUPAC name is 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(propylsulfonylamino)thiophene-2-carboxylic acid.
| Compound Name | 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(propylsulfonylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170963521 |
| Molecular Formula | C29H34ClN3O6S3 |
| Molecular Weight | 652.26 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-3-(propylsulfonylamino)thiophene-2-carboxylic acid |
| SMILES | CCCS(=O)(=O)Nc1cc(-c2cc3c(cc2Cl)N(c2ccccc2)C[C@@H](C2CCCCC2)N(C)S3(=O)=O)sc1C(=O)O |
| InChI | InChI=1S/C29H34ClN3O6S3/c1-3-14-41(36,37)31-23-17-26(40-28(23)29(34)35)21-15-27-24(16-22(21)30)33(20-12-8-5-9-13-20)18-25(32(2)42(27,38)39)19-10-6-4-7-11-19/h5,8-9,12-13,15-17,19,25,31H,3-4,6-7,10-11,14,18H2,1-2H3,(H,34,35)/t25-/m0/s1 |
| InChIKey | CNTJJSYECBECKC-VWLOTQADSA-N |
| XLogP | 6.64 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.26 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |