C36H38ClN3O6S2 — CID 171450678
5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(2-phenylethylsulfonylamino)benzoic acid (PubChem CID 171450678) has the molecular formula C36H38ClN3O6S2 and a molecular weight of 708.30 g/mol. Its IUPAC name is 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(2-phenylethylsulfonylamino)benzoic acid.
| Compound Name | 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(2-phenylethylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 171450678 |
| Molecular Formula | C36H38ClN3O6S2 |
| Molecular Weight | 708.30 g/mol |
| Exact Mass | 707.19 |
| IUPAC Name | 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(2-phenylethylsulfonylamino)benzoic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(Cl)c(-c3ccc(NS(=O)(=O)CCc4ccccc4)c(C(=O)O)c3)cc2S1(=O)=O |
| InChI | InChI=1S/C36H38ClN3O6S2/c1-39-34(26-13-7-3-8-14-26)24-40(28-15-9-4-10-16-28)33-23-31(37)29(22-35(33)48(39,45)46)27-17-18-32(30(21-27)36(41)42)38-47(43,44)20-19-25-11-5-2-6-12-25/h2,4-6,9-12,15-18,21-23,26,34,38H,3,7-8,13-14,19-20,24H2,1H3,(H,41,42)/t34-/m0/s1 |
| InChIKey | ZBNJZGXEFYDIEJ-UMSFTDKQSA-N |
| XLogP | 7.41 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.30 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |