C25H33Cl2N3O4S — CID 177286320
(2R)-2-amino-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]butanoic acid;hydrochloride (PubChem CID 177286320) has the molecular formula C25H33Cl2N3O4S and a molecular weight of 542.53 g/mol. Its IUPAC name is (2R)-2-amino-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]butanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 177286320 |
| Molecular Formula | C25H33Cl2N3O4S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (2R)-2-amino-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]butanoic acid;hydrochloride |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(Cl)c(CC[C@@H](N)C(=O)O)cc2S1(=O)=O.Cl |
| InChI | InChI=1S/C25H32ClN3O4S.ClH/c1-28-23(17-8-4-2-5-9-17)16-29(19-10-6-3-7-11-19)22-15-20(26)18(12-13-21(27)25(30)31)14-24(22)34(28,32)33;/h3,6-7,10-11,14-15,17,21,23H,2,4-5,8-9,12-13,16,27H2,1H3,(H,30,31);1H/t21-,23+;/m1./s1 |
| InChIKey | YAUUPTNDEKBQQV-QRIJJCFISA-N |
| XLogP | 4.83 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |