C35H35ClN4O5S — CID 170963669
5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(phenylcarbamoylamino)benzoic acid (PubChem CID 170963669) has the molecular formula C35H35ClN4O5S and a molecular weight of 659.21 g/mol. Its IUPAC name is 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(phenylcarbamoylamino)benzoic acid.
| Compound Name | 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(phenylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 170963669 |
| Molecular Formula | C35H35ClN4O5S |
| Molecular Weight | 659.21 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | 5-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(phenylcarbamoylamino)benzoic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(Cl)c(-c3ccc(NC(=O)Nc4ccccc4)c(C(=O)O)c3)cc2S1(=O)=O |
| InChI | InChI=1S/C35H35ClN4O5S/c1-39-32(23-11-5-2-6-12-23)22-40(26-15-9-4-10-16-26)31-21-29(36)27(20-33(31)46(39,44)45)24-17-18-30(28(19-24)34(41)42)38-35(43)37-25-13-7-3-8-14-25/h3-4,7-10,13-21,23,32H,2,5-6,11-12,22H2,1H3,(H,41,42)(H2,37,38,43)/t32-/m0/s1 |
| InChIKey | DGZJXBLMAMANDQ-YTTGMZPUSA-N |
| XLogP | 8.07 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.21 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |