C25H27ClN4O4S — CID 170963512
3-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1H-pyrazole-5-carboxylic acid (PubChem CID 170963512) has the molecular formula C25H27ClN4O4S and a molecular weight of 515.04 g/mol. Its IUPAC name is 3-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 170963512 |
| Molecular Formula | C25H27ClN4O4S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 3-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-1H-pyrazole-5-carboxylic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(Cl)c(-c3cc(C(=O)O)[nH]n3)cc2S1(=O)=O |
| InChI | InChI=1S/C25H27ClN4O4S/c1-29-23(16-8-4-2-5-9-16)15-30(17-10-6-3-7-11-17)22-13-19(26)18(12-24(22)35(29,33)34)20-14-21(25(31)32)28-27-20/h3,6-7,10-14,16,23H,2,4-5,8-9,15H2,1H3,(H,27,28)(H,31,32)/t23-/m0/s1 |
| InChIKey | ABNONELZEOOPIL-QHCPKHFHSA-N |
| XLogP | 5.15 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |