C27H35ClN2O4S — CID 177286262
4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2,2-dimethylbutanoic acid (PubChem CID 177286262) has the molecular formula C27H35ClN2O4S and a molecular weight of 519.11 g/mol. Its IUPAC name is 4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 177286262 |
| Molecular Formula | C27H35ClN2O4S |
| Molecular Weight | 519.11 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2,2-dimethylbutanoic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(Cl)c(CCC(C)(C)C(=O)O)cc2S1(=O)=O |
| InChI | InChI=1S/C27H35ClN2O4S/c1-27(2,26(31)32)15-14-20-16-25-23(17-22(20)28)30(21-12-8-5-9-13-21)18-24(29(3)35(25,33)34)19-10-6-4-7-11-19/h5,8-9,12-13,16-17,19,24H,4,6-7,10-11,14-15,18H2,1-3H3,(H,31,32)/t24-/m0/s1 |
| InChIKey | HMNYJEKFVAZTKD-DEOSSOPVSA-N |
| XLogP | 6.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.11 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |