C34H31FN2O4S2 — CID 170963717
5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2-thiophen-3-ylethynyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-fluorobenzoic acid (PubChem CID 170963717) has the molecular formula C34H31FN2O4S2 and a molecular weight of 614.76 g/mol. Its IUPAC name is 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2-thiophen-3-ylethynyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-fluorobenzoic acid.
| Compound Name | 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2-thiophen-3-ylethynyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170963717 |
| Molecular Formula | C34H31FN2O4S2 |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | 5-[(3R)-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-7-(2-thiophen-3-ylethynyl)-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-fluorobenzoic acid |
| SMILES | CN1[C@H](C2CCCCC2)CN(c2ccccc2)c2cc(C#Cc3ccsc3)c(-c3ccc(F)c(C(=O)O)c3)cc2S1(=O)=O |
| InChI | InChI=1S/C34H31FN2O4S2/c1-36-32(24-8-4-2-5-9-24)21-37(27-10-6-3-7-11-27)31-19-26(13-12-23-16-17-42-22-23)28(20-33(31)43(36,40)41)25-14-15-30(35)29(18-25)34(38)39/h3,6-7,10-11,14-20,22,24,32H,2,4-5,8-9,21H2,1H3,(H,38,39)/t32-/m0/s1 |
| InChIKey | HBFUULGFQICIRE-YTTGMZPUSA-N |
| XLogP | 7.37 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|