C35H50ClN3O6S — CID 177286315
(2R)-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(nonoxycarbonylamino)butanoic acid (PubChem CID 177286315) has the molecular formula C35H50ClN3O6S and a molecular weight of 676.32 g/mol. Its IUPAC name is (2R)-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(nonoxycarbonylamino)butanoic acid.
| Compound Name | (2R)-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(nonoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 177286315 |
| Molecular Formula | C35H50ClN3O6S |
| Molecular Weight | 676.32 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | (2R)-4-[(3R)-7-chloro-3-cyclohexyl-2-methyl-1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-yl]-2-(nonoxycarbonylamino)butanoic acid |
| SMILES | CCCCCCCCCOC(=O)N[C@H](CCc1cc2c(cc1Cl)N(c1ccccc1)C[C@@H](C1CCCCC1)N(C)S2(=O)=O)C(=O)O |
| InChI | InChI=1S/C35H50ClN3O6S/c1-3-4-5-6-7-8-15-22-45-35(42)37-30(34(40)41)21-20-27-23-33-31(24-29(27)36)39(28-18-13-10-14-19-28)25-32(38(2)46(33,43)44)26-16-11-9-12-17-26/h10,13-14,18-19,23-24,26,30,32H,3-9,11-12,15-17,20-22,25H2,1-2H3,(H,37,42)(H,40,41)/t30-,32+/m1/s1 |
| InChIKey | SXOZGEUERYURQH-BHYZAODMSA-N |
| XLogP | 7.92 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.32 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|