C7H11N3O3 — CID 174213756
ethene;1,3,5-triazinane-2,4,6-trione (PubChem CID 174213756) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is ethene;1,3,5-triazinane-2,4,6-trione.
| Compound Name | ethene;1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 174213756 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | ethene;1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C.C=C.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C3H3N3O3.2C2H4/c7-1-4-2(8)6-3(9)5-1;2*1-2/h(H3,4,5,6,7,8,9);2*1-2H2 |
| InChIKey | VDPCNKFIAFLGJH-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|