About bis(dihydroxyphosphanyl) (Z)-but-2-enedioate
bis(dihydroxyphosphanyl) (Z)-but-2-enedioate (PubChem CID 174215356) has the molecular formula C4H6O8P2
and a molecular weight of 244.03 g/mol. Its IUPAC name is bis(dihydroxyphosphanyl) (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | bis(dihydroxyphosphanyl) (Z)-but-2-enedioate |
| PubChem CID | 174215356 |
| Molecular Formula | C4H6O8P2 |
| Molecular Weight | 244.03 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | bis(dihydroxyphosphanyl) (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)OP(O)O)OP(O)O |
| InChI | InChI=1S/C4H6O8P2/c5-3(11-13(7)8)1-2-4(6)12-14(9)10/h1-2,7-10H/b2-1- |
| InChIKey | VEZYOTYLJUAUJB-UPHRSURJSA-N |
| XLogP | -0.95 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.03 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxyphosphanyl) (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxyphosphanyl) (Z)-but-2-enedioate?
The IUPAC name of bis(dihydroxyphosphanyl) (Z)-but-2-enedioate (CID 174215356) is bis(dihydroxyphosphanyl) (Z)-but-2-enedioate.
What is the SMILES notation for bis(dihydroxyphosphanyl) (Z)-but-2-enedioate?
The canonical SMILES for bis(dihydroxyphosphanyl) (Z)-but-2-enedioate is O=C(/C=C\C(=O)OP(O)O)OP(O)O.
What is the InChIKey of bis(dihydroxyphosphanyl) (Z)-but-2-enedioate?
The InChIKey is VEZYOTYLJUAUJB-UPHRSURJSA-N. The full InChI is InChI=1S/C4H6O8P2/c5-3(11-13(7)8)1-2-4(6)12-14(9)10/h1-2,7-10H/b2-1-.
What are the key properties of bis(dihydroxyphosphanyl) (Z)-but-2-enedioate?
bis(dihydroxyphosphanyl) (Z)-but-2-enedioate has a molecular weight of 244.03 g/mol, XLogP of -0.95, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxyphosphanyl) (Z)-but-2-enedioate is sourced from PubChem (CID 174215356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).