About diiodo (Z)-but-2-enedioate
diiodo (Z)-but-2-enedioate (PubChem CID 159859279) has the molecular formula C4H2I2O4
and a molecular weight of 367.86 g/mol. Its IUPAC name is diiodo (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | diiodo (Z)-but-2-enedioate |
| PubChem CID | 159859279 |
| Molecular Formula | C4H2I2O4 |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.80 |
| IUPAC Name | diiodo (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)OI)OI |
| InChI | InChI=1S/C4H2I2O4/c5-9-3(7)1-2-4(8)10-6/h1-2H/b2-1- |
| InChIKey | NQXSDJBLIWJVOB-UPHRSURJSA-N |
| XLogP | 1.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diiodo (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodo (Z)-but-2-enedioate?
The IUPAC name of diiodo (Z)-but-2-enedioate (CID 159859279) is diiodo (Z)-but-2-enedioate.
What is the SMILES notation for diiodo (Z)-but-2-enedioate?
The canonical SMILES for diiodo (Z)-but-2-enedioate is O=C(/C=C\C(=O)OI)OI.
What is the InChIKey of diiodo (Z)-but-2-enedioate?
The InChIKey is NQXSDJBLIWJVOB-UPHRSURJSA-N. The full InChI is InChI=1S/C4H2I2O4/c5-9-3(7)1-2-4(8)10-6/h1-2H/b2-1-.
What are the key properties of diiodo (Z)-but-2-enedioate?
diiodo (Z)-but-2-enedioate has a molecular weight of 367.86 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diiodo (Z)-but-2-enedioate is sourced from PubChem (CID 159859279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).