About sodium iodo carbonate
sodium iodo carbonate (PubChem CID 174948580) has the molecular formula CINaO3
and a molecular weight of 209.90 g/mol. Its IUPAC name is sodium iodo carbonate.
Molecular Properties
| Compound Name | sodium iodo carbonate |
| PubChem CID | 174948580 |
| Molecular Formula | CINaO3 |
| Molecular Weight | 209.90 g/mol |
| Exact Mass | 209.88 |
| IUPAC Name | sodium iodo carbonate |
| SMILES | O=C([O-])OI.[Na+] |
| InChI | InChI=1S/CHIO3.Na/c2-5-1(3)4;/h(H,3,4);/q;+1/p-1 |
| InChIKey | KUTNPXYTIGXTBQ-UHFFFAOYSA-M |
| XLogP | -3.30 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.90 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium iodo carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium iodo carbonate?
The IUPAC name of sodium iodo carbonate (CID 174948580) is sodium iodo carbonate.
What is the SMILES notation for sodium iodo carbonate?
The canonical SMILES for sodium iodo carbonate is O=C([O-])OI.[Na+].
What is the InChIKey of sodium iodo carbonate?
The InChIKey is KUTNPXYTIGXTBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/CHIO3.Na/c2-5-1(3)4;/h(H,3,4);/q;+1/p-1.
What are the key properties of sodium iodo carbonate?
sodium iodo carbonate has a molecular weight of 209.90 g/mol, XLogP of -3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium iodo carbonate is sourced from PubChem (CID 174948580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).