sodium iodo carbonate

CINaO3 — CID 174948580

IUPACsodium iodo carbonate
SMILESO=C([O-])OI.[Na+]
InChIInChI=1S/CHIO3.Na/c2-5-1(3)4;/h(H,3,4);/q;+1/p-1
InChIKeyKUTNPXYTIGXTBQ-UHFFFAOYSA-M
MW209.90 g/mol
LogP-3.30
Rot. Bonds

About sodium iodo carbonate

sodium iodo carbonate (PubChem CID 174948580) has the molecular formula CINaO3 and a molecular weight of 209.90 g/mol. Its IUPAC name is sodium iodo carbonate.

Molecular Properties

Compound Namesodium iodo carbonate
PubChem CID174948580
Molecular FormulaCINaO3
Molecular Weight209.90 g/mol
Exact Mass209.88
IUPAC Namesodium iodo carbonate
SMILESO=C([O-])OI.[Na+]
InChIInChI=1S/CHIO3.Na/c2-5-1(3)4;/h(H,3,4);/q;+1/p-1
InChIKeyKUTNPXYTIGXTBQ-UHFFFAOYSA-M
XLogP-3.30
TPSA49.36 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.90
LogP ≤ 5-3.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze sodium iodo carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium iodo carbonate?
The IUPAC name of sodium iodo carbonate (CID 174948580) is sodium iodo carbonate.
What is the SMILES notation for sodium iodo carbonate?
The canonical SMILES for sodium iodo carbonate is O=C([O-])OI.[Na+].
What is the InChIKey of sodium iodo carbonate?
The InChIKey is KUTNPXYTIGXTBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/CHIO3.Na/c2-5-1(3)4;/h(H,3,4);/q;+1/p-1.
What are the key properties of sodium iodo carbonate?
sodium iodo carbonate has a molecular weight of 209.90 g/mol, XLogP of -3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium iodo carbonate is sourced from PubChem (CID 174948580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).