About methane;methyl carbonate;molecular iodine
methane;methyl carbonate;molecular iodine (PubChem CID 159941890) has the molecular formula C3H7I2O3-
and a molecular weight of 344.89 g/mol. Its IUPAC name is methane;methyl carbonate;molecular iodine.
Molecular Properties
| Compound Name | methane;methyl carbonate;molecular iodine |
| PubChem CID | 159941890 |
| Molecular Formula | C3H7I2O3- |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.85 |
| IUPAC Name | methane;methyl carbonate;molecular iodine |
| SMILES | C.COC(=O)[O-].II |
| InChI | InChI=1S/C2H4O3.CH4.I2/c1-5-2(3)4;;1-2/h1H3,(H,3,4);1H4;/p-1 |
| InChIKey | OAZGVEOCRIQSNY-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl carbonate;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl carbonate;molecular iodine?
The IUPAC name of methane;methyl carbonate;molecular iodine (CID 159941890) is methane;methyl carbonate;molecular iodine.
What is the SMILES notation for methane;methyl carbonate;molecular iodine?
The canonical SMILES for methane;methyl carbonate;molecular iodine is C.COC(=O)[O-].II.
What is the InChIKey of methane;methyl carbonate;molecular iodine?
The InChIKey is OAZGVEOCRIQSNY-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3.CH4.I2/c1-5-2(3)4;;1-2/h1H3,(H,3,4);1H4;/p-1.
What are the key properties of methane;methyl carbonate;molecular iodine?
methane;methyl carbonate;molecular iodine has a molecular weight of 344.89 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl carbonate;molecular iodine is sourced from PubChem (CID 159941890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).