C20H24N4O2S — CID 174219660
1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(1-methylpiperidin-3-yl)phenyl]ethyl]urea (PubChem CID 174219660) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(1-methylpiperidin-3-yl)phenyl]ethyl]urea.
| Compound Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(1-methylpiperidin-3-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 174219660 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-(2-ethynyl-1,3-thiazol-4-yl)-3-[2-hydroxy-1-[4-(1-methylpiperidin-3-yl)phenyl]ethyl]urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(C3CCCN(C)C3)cc2)cs1 |
| InChI | InChI=1S/C20H24N4O2S/c1-3-19-22-18(13-27-19)23-20(26)21-17(12-25)15-8-6-14(7-9-15)16-5-4-10-24(2)11-16/h1,6-9,13,16-17,25H,4-5,10-12H2,2H3,(H2,21,23,26) |
| InChIKey | USGPVYRPPORERC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|