C17H16F2N4O2S — CID 169223151
1-[(1R)-1-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 169223151) has the molecular formula C17H16F2N4O2S and a molecular weight of 378.40 g/mol. Its IUPAC name is 1-[(1R)-1-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[(1R)-1-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 169223151 |
| Molecular Formula | C17H16F2N4O2S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-[(1R)-1-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)N[C@@H](CO)c2ccc(N3CC(F)(F)C3)cc2)cs1 |
| InChI | InChI=1S/C17H16F2N4O2S/c1-2-15-21-14(8-26-15)22-16(25)20-13(7-24)11-3-5-12(6-4-11)23-9-17(18,19)10-23/h1,3-6,8,13,24H,7,9-10H2,(H2,20,22,25)/t13-/m0/s1 |
| InChIKey | WNQUUKQYDSLDOQ-ZDUSSCGKSA-N |
| XLogP | 2.43 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|