C23H20F2N4O2S — CID 167101570
1-[1-[4-[3-(3,3-difluoroazetidin-1-yl)phenyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 167101570) has the molecular formula C23H20F2N4O2S and a molecular weight of 454.50 g/mol. Its IUPAC name is 1-[1-[4-[3-(3,3-difluoroazetidin-1-yl)phenyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[1-[4-[3-(3,3-difluoroazetidin-1-yl)phenyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 167101570 |
| Molecular Formula | C23H20F2N4O2S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[1-[4-[3-(3,3-difluoroazetidin-1-yl)phenyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(-c3cccc(N4CC(F)(F)C4)c3)cc2)cs1 |
| InChI | InChI=1S/C23H20F2N4O2S/c1-2-21-27-20(12-32-21)28-22(31)26-19(11-30)16-8-6-15(7-9-16)17-4-3-5-18(10-17)29-13-23(24,25)14-29/h1,3-10,12,19,30H,11,13-14H2,(H2,26,28,31) |
| InChIKey | KGBKRUBNOBOCHD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|