C12H22N2O6 — CID 174221633
3-amino-4-[[1-hydroxy-1-(2-methylbutanoyloxy)propan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 174221633) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-amino-4-[[1-hydroxy-1-(2-methylbutanoyloxy)propan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-hydroxy-1-(2-methylbutanoyloxy)propan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174221633 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-amino-4-[[1-hydroxy-1-(2-methylbutanoyloxy)propan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(=O)OC(O)C(C)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C12H22N2O6/c1-4-6(2)11(18)20-12(19)7(3)14-10(17)8(13)5-9(15)16/h6-8,12,19H,4-5,13H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | IEKVKVKOGYVAAT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|