C6H8FN3O — CID 174222679
1-[(3R,4R)-4-fluorooxolan-3-yl]triazole (PubChem CID 174222679) has the molecular formula C6H8FN3O and a molecular weight of 157.15 g/mol. Its IUPAC name is 1-[(3R,4R)-4-fluorooxolan-3-yl]triazole.
| Compound Name | 1-[(3R,4R)-4-fluorooxolan-3-yl]triazole |
|---|---|
| PubChem CID | 174222679 |
| Molecular Formula | C6H8FN3O |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-[(3R,4R)-4-fluorooxolan-3-yl]triazole |
| SMILES | F[C@H]1COC[C@H]1n1ccnn1 |
| InChI | InChI=1S/C6H8FN3O/c7-5-3-11-4-6(5)10-2-1-8-9-10/h1-2,5-6H,3-4H2/t5-,6+/m0/s1 |
| InChIKey | MGQHYRAYCALDDE-NTSWFWBYSA-N |
| XLogP | 0.19 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |