C20H13F4N7O5S — CID 174224964
[1-[4-cyano-8-oxo-12-(trifluoromethyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-yl]-2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] ethanesulfonate (PubChem CID 174224964) has the molecular formula C20H13F4N7O5S and a molecular weight of 539.43 g/mol. Its IUPAC name is [1-[4-cyano-8-oxo-12-(trifluoromethyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-yl]-2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] ethanesulfonate.
| Compound Name | [1-[4-cyano-8-oxo-12-(trifluoromethyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-yl]-2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] ethanesulfonate |
|---|---|
| PubChem CID | 174224964 |
| Molecular Formula | C20H13F4N7O5S |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | [1-[4-cyano-8-oxo-12-(trifluoromethyl)-2,3,7,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-yl]-2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)OC(C(=O)Nc1ccc(F)cn1)n1c(=O)c2ccc(C(F)(F)F)nc2n2nc(C#N)cc12 |
| InChI | InChI=1S/C20H13F4N7O5S/c1-2-37(34,35)36-19(17(32)28-14-6-3-10(21)9-26-14)30-15-7-11(8-25)29-31(15)16-12(18(30)33)4-5-13(27-16)20(22,23)24/h3-7,9,19H,2H2,1H3,(H,26,28,32) |
| InChIKey | ZKJKKUSDRCZJGO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|