C18H9B7N6O2 — CID 174028328
CID 174028328 (PubChem CID 174028328) has the molecular formula C18H9B7N6O2 and a molecular weight of 416.99 g/mol.
| Compound Name | CID 174028328 |
|---|---|
| PubChem CID | 174028328 |
| Molecular Formula | C18H9B7N6O2 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)Cn2c(=O)c3ccc(C([B])([B])[B])nc3n3nc(C([B])([B])[B])cc23)nc1 |
| InChI | InChI=1S/C18H9B7N6O2/c19-8-1-4-12(26-6-8)28-13(32)7-30-14-5-11(18(23,24)25)29-31(14)15-9(16(30)33)2-3-10(27-15)17(20,21)22/h1-6H,7H2,(H,26,28,32) |
| InChIKey | YRJWSWBLWVJPCD-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|