C23H25NO5 — CID 174226393
[(1S)-1-formyl-6-[2-(2-methoxyethoxy)phenyl]spiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-yl]carbamic acid (PubChem CID 174226393) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(1S)-1-formyl-6-[2-(2-methoxyethoxy)phenyl]spiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-yl]carbamic acid.
| Compound Name | [(1S)-1-formyl-6-[2-(2-methoxyethoxy)phenyl]spiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-yl]carbamic acid |
|---|---|
| PubChem CID | 174226393 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(1S)-1-formyl-6-[2-(2-methoxyethoxy)phenyl]spiro[3,4-dihydronaphthalene-2,1'-cyclopropane]-1-yl]carbamic acid |
| SMILES | COCCOc1ccccc1-c1ccc2c(c1)CCC1(CC1)[C@]2(C=O)NC(=O)O |
| InChI | InChI=1S/C23H25NO5/c1-28-12-13-29-20-5-3-2-4-18(20)16-6-7-19-17(14-16)8-9-22(10-11-22)23(19,15-25)24-21(26)27/h2-7,14-15,24H,8-13H2,1H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | REODPVJLSFSQKX-HSZRJFAPSA-N |
| XLogP | 3.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|