C20H19NO3 — CID 174226518
[(1S)-6-(3-ethylphenyl)-1-formyl-4H-naphthalen-1-yl]carbamic acid (PubChem CID 174226518) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is [(1S)-6-(3-ethylphenyl)-1-formyl-4H-naphthalen-1-yl]carbamic acid.
| Compound Name | [(1S)-6-(3-ethylphenyl)-1-formyl-4H-naphthalen-1-yl]carbamic acid |
|---|---|
| PubChem CID | 174226518 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(1S)-6-(3-ethylphenyl)-1-formyl-4H-naphthalen-1-yl]carbamic acid |
| SMILES | CCc1cccc(-c2ccc3c(c2)CC=C[C@]3(C=O)NC(=O)O)c1 |
| InChI | InChI=1S/C20H19NO3/c1-2-14-5-3-6-15(11-14)16-8-9-18-17(12-16)7-4-10-20(18,13-22)21-19(23)24/h3-6,8-13,21H,2,7H2,1H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | KCURZIHNEYXGSD-HXUWFJFHSA-N |
| XLogP | 3.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|