C17H19N3O7 — CID 17423258
N-(1,3-benzodioxol-5-yl)-2-[3-(3-ethoxypropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 17423258) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-(3-ethoxypropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-(3-ethoxypropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 17423258 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-(3-ethoxypropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CCOCCCN1C(=O)C(=O)N(CC(=O)Nc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C17H19N3O7/c1-2-25-7-3-6-19-15(22)16(23)20(17(19)24)9-14(21)18-11-4-5-12-13(8-11)27-10-26-12/h4-5,8H,2-3,6-7,9-10H2,1H3,(H,18,21) |
| InChIKey | NVMSUDXNYBHZKV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|