C27H30N4O5 — CID 174238783
[3-[4-[2-[4-[[6-(hydrazinecarbonyl)-2-pyridinyl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid (PubChem CID 174238783) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is [3-[4-[2-[4-[[6-(hydrazinecarbonyl)-2-pyridinyl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid.
| Compound Name | [3-[4-[2-[4-[[6-(hydrazinecarbonyl)-2-pyridinyl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 174238783 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [3-[4-[2-[4-[[6-(hydrazinecarbonyl)-2-pyridinyl]methoxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid |
| SMILES | CC(C)(c1ccc(OCc2cccc(C(=O)NN)n2)cc1)c1ccc(OC2CC(NC(=O)O)C2)cc1 |
| InChI | InChI=1S/C27H30N4O5/c1-27(2,18-8-12-22(13-9-18)36-23-14-20(15-23)30-26(33)34)17-6-10-21(11-7-17)35-16-19-4-3-5-24(29-19)25(32)31-28/h3-13,20,23,30H,14-16,28H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | XIYYGJQEIMHZKQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|