C28H28N4O7 — CID 174238819
[3-[4-[2-[4-[[5-(3-hydrazinyl-2,3-dioxopropanoyl)-2-pyridinyl]oxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid (PubChem CID 174238819) has the molecular formula C28H28N4O7 and a molecular weight of 532.55 g/mol. Its IUPAC name is [3-[4-[2-[4-[[5-(3-hydrazinyl-2,3-dioxopropanoyl)-2-pyridinyl]oxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid.
| Compound Name | [3-[4-[2-[4-[[5-(3-hydrazinyl-2,3-dioxopropanoyl)-2-pyridinyl]oxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 174238819 |
| Molecular Formula | C28H28N4O7 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [3-[4-[2-[4-[[5-(3-hydrazinyl-2,3-dioxopropanoyl)-2-pyridinyl]oxy]phenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid |
| SMILES | CC(C)(c1ccc(Oc2ccc(C(=O)C(=O)C(=O)NN)cn2)cc1)c1ccc(OC2CC(NC(=O)O)C2)cc1 |
| InChI | InChI=1S/C28H28N4O7/c1-28(2,17-4-8-20(9-5-17)38-22-13-19(14-22)31-27(36)37)18-6-10-21(11-7-18)39-23-12-3-16(15-30-23)24(33)25(34)26(35)32-29/h3-12,15,19,22,31H,13-14,29H2,1-2H3,(H,32,35)(H,36,37) |
| InChIKey | LVWSZFVRLZAFCX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|