C25H24N4O4 — CID 174238856
[3-[4-[2-[4-(4-cyanopyrimidin-2-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid (PubChem CID 174238856) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is [3-[4-[2-[4-(4-cyanopyrimidin-2-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid.
| Compound Name | [3-[4-[2-[4-(4-cyanopyrimidin-2-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 174238856 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [3-[4-[2-[4-(4-cyanopyrimidin-2-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl]carbamic acid |
| SMILES | CC(C)(c1ccc(Oc2nccc(C#N)n2)cc1)c1ccc(OC2CC(NC(=O)O)C2)cc1 |
| InChI | InChI=1S/C25H24N4O4/c1-25(2,16-3-7-20(8-4-16)32-22-13-19(14-22)29-24(30)31)17-5-9-21(10-6-17)33-23-27-12-11-18(15-26)28-23/h3-12,19,22,29H,13-14H2,1-2H3,(H,30,31) |
| InChIKey | MDICWLFULHIEDY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |