C26H24N6O4 — CID 174240251
2-oxo-6-(4-phenoxyphenyl)-4-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,3-dihydroimidazo[4,5-c]pyridine-7-carboxamide (PubChem CID 174240251) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-oxo-6-(4-phenoxyphenyl)-4-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,3-dihydroimidazo[4,5-c]pyridine-7-carboxamide.
| Compound Name | 2-oxo-6-(4-phenoxyphenyl)-4-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,3-dihydroimidazo[4,5-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 174240251 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-oxo-6-(4-phenoxyphenyl)-4-[3-(prop-2-enoylamino)pyrrolidin-1-yl]-1,3-dihydroimidazo[4,5-c]pyridine-7-carboxamide |
| SMILES | C=CC(=O)NC1CCN(c2nc(-c3ccc(Oc4ccccc4)cc3)c(C(N)=O)c3[nH]c(=O)[nH]c23)C1 |
| InChI | InChI=1S/C26H24N6O4/c1-2-19(33)28-16-12-13-32(14-16)25-23-22(30-26(35)31-23)20(24(27)34)21(29-25)15-8-10-18(11-9-15)36-17-6-4-3-5-7-17/h2-11,16H,1,12-14H2,(H2,27,34)(H,28,33)(H2,30,31,35) |
| InChIKey | MLIPSEHZDNDWIS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|