C26H28N4O4 — CID 153201797
2-methyl-6-(4-phenoxyphenoxy)-2-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-3H-pyridine-5-carboxamide (PubChem CID 153201797) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-methyl-6-(4-phenoxyphenoxy)-2-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-3H-pyridine-5-carboxamide.
| Compound Name | 2-methyl-6-(4-phenoxyphenoxy)-2-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-3H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 153201797 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-methyl-6-(4-phenoxyphenoxy)-2-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-3H-pyridine-5-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCN(C2(C)CC=C(C(N)=O)C(Oc3ccc(Oc4ccccc4)cc3)=N2)C1 |
| InChI | InChI=1S/C26H28N4O4/c1-3-23(31)28-18-14-16-30(17-18)26(2)15-13-22(24(27)32)25(29-26)34-21-11-9-20(10-12-21)33-19-7-5-4-6-8-19/h3-13,18H,1,14-17H2,2H3,(H2,27,32)(H,28,31)/t18-,26?/m0/s1 |
| InChIKey | WKBFXKXOINNWQN-MDYZWHIJSA-N |
| XLogP | 3.16 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|