C25H27N5O2 — CID 154977667
N-[2-carbamimidoyl-3-(methylamino)-1-(4-phenoxyphenyl)-5,6,7,8-tetrahydroindolizin-6-yl]prop-2-enamide (PubChem CID 154977667) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-carbamimidoyl-3-(methylamino)-1-(4-phenoxyphenyl)-5,6,7,8-tetrahydroindolizin-6-yl]prop-2-enamide.
| Compound Name | N-[2-carbamimidoyl-3-(methylamino)-1-(4-phenoxyphenyl)-5,6,7,8-tetrahydroindolizin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154977667 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[2-carbamimidoyl-3-(methylamino)-1-(4-phenoxyphenyl)-5,6,7,8-tetrahydroindolizin-6-yl]prop-2-enamide |
| SMILES | [H]/N=C(\N)c1c(-c2ccc(Oc3ccccc3)cc2)c2n(c1NC)CC(NC(=O)C=C)CC2 |
| InChI | InChI=1S/C25H27N5O2/c1-3-21(31)29-17-11-14-20-22(23(24(26)27)25(28-2)30(20)15-17)16-9-12-19(13-10-16)32-18-7-5-4-6-8-18/h3-10,12-13,17,28H,1,11,14-15H2,2H3,(H3,26,27)(H,29,31) |
| InChIKey | AUDKWEWIZKVTHF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|