C26H28N6O2 — CID 146631640
N-[4-[4-amino-3-(4-phenoxyphenyl)-3a,4-dihydropyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide (PubChem CID 146631640) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[4-[4-amino-3-(4-phenoxyphenyl)-3a,4-dihydropyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[4-amino-3-(4-phenoxyphenyl)-3a,4-dihydropyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 146631640 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | N-[4-[4-amino-3-(4-phenoxyphenyl)-3a,4-dihydropyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(N2N=C(c3ccc(Oc4ccccc4)cc3)C3C2=NC=NC3N)CC1 |
| InChI | InChI=1S/C26H28N6O2/c1-2-22(33)30-18-10-12-19(13-11-18)32-26-23(25(27)28-16-29-26)24(31-32)17-8-14-21(15-9-17)34-20-6-4-3-5-7-20/h2-9,14-16,18-19,23,25H,1,10-13,27H2,(H,30,33) |
| InChIKey | PXXVQYZCAPMKDO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|