C30H31N5O2 — CID 123806001
N-[4-[6-amino-8-(4-phenoxyphenyl)-3,5,9-triazatricyclo[8.1.1.02,7]dodeca-2(7),3,5,8-tetraen-11-yl]cyclohexyl]prop-2-enamide (PubChem CID 123806001) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[4-[6-amino-8-(4-phenoxyphenyl)-3,5,9-triazatricyclo[8.1.1.02,7]dodeca-2(7),3,5,8-tetraen-11-yl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[6-amino-8-(4-phenoxyphenyl)-3,5,9-triazatricyclo[8.1.1.02,7]dodeca-2(7),3,5,8-tetraen-11-yl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 123806001 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[4-[6-amino-8-(4-phenoxyphenyl)-3,5,9-triazatricyclo[8.1.1.02,7]dodeca-2(7),3,5,8-tetraen-11-yl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(C2C3CC2c2ncnc(N)c2C(c2ccc(Oc4ccccc4)cc2)=N3)CC1 |
| InChI | InChI=1S/C30H31N5O2/c1-2-25(36)34-20-12-8-18(9-13-20)26-23-16-24(26)35-28(27-29(23)32-17-33-30(27)31)19-10-14-22(15-11-19)37-21-6-4-3-5-7-21/h2-7,10-11,14-15,17-18,20,23-24,26H,1,8-9,12-13,16H2,(H,34,36)(H2,31,32,33) |
| InChIKey | MIYKACPDTRXADP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|