C30H31N5O2 — CID 123275774
N-[4-[4-amino-9-methyl-5-(4-phenoxyphenyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-8-yl]cyclohexyl]prop-2-ynamide (PubChem CID 123275774) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[4-[4-amino-9-methyl-5-(4-phenoxyphenyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-8-yl]cyclohexyl]prop-2-ynamide.
| Compound Name | N-[4-[4-amino-9-methyl-5-(4-phenoxyphenyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-8-yl]cyclohexyl]prop-2-ynamide |
|---|---|
| PubChem CID | 123275774 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[4-[4-amino-9-methyl-5-(4-phenoxyphenyl)-8,9-dihydro-7H-pyrimido[5,4-c]azepin-8-yl]cyclohexyl]prop-2-ynamide |
| SMILES | C#CC(=O)NC1CCC(C2CN=C(c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc3C2C)CC1 |
| InChI | InChI=1S/C30H31N5O2/c1-3-26(36)35-22-13-9-20(10-14-22)25-17-32-29(27-28(19(25)2)33-18-34-30(27)31)21-11-15-24(16-12-21)37-23-7-5-4-6-8-23/h1,4-8,11-12,15-16,18-20,22,25H,9-10,13-14,17H2,2H3,(H,35,36)(H2,31,33,34) |
| InChIKey | QCTGYIULUDBLDM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|