C20H28BrN5O2 — CID 174240534
tert-butyl 4-[2-[(8-bromoquinazolin-4-yl)amino]propyl]piperazine-1-carboxylate (PubChem CID 174240534) has the molecular formula C20H28BrN5O2 and a molecular weight of 450.38 g/mol. Its IUPAC name is tert-butyl 4-[2-[(8-bromoquinazolin-4-yl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(8-bromoquinazolin-4-yl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174240534 |
| Molecular Formula | C20H28BrN5O2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | tert-butyl 4-[2-[(8-bromoquinazolin-4-yl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(CN1CCN(C(=O)OC(C)(C)C)CC1)Nc1ncnc2c(Br)cccc12 |
| InChI | InChI=1S/C20H28BrN5O2/c1-14(24-18-15-6-5-7-16(21)17(15)22-13-23-18)12-25-8-10-26(11-9-25)19(27)28-20(2,3)4/h5-7,13-14H,8-12H2,1-4H3,(H,22,23,24) |
| InChIKey | XPAKATRWLLQMHR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |