C19H28N6 — CID 174240638
N-(1-piperazin-1-ylpropan-2-yl)-8-pyrrolidin-1-ylquinazolin-4-amine (PubChem CID 174240638) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is N-(1-piperazin-1-ylpropan-2-yl)-8-pyrrolidin-1-ylquinazolin-4-amine.
| Compound Name | N-(1-piperazin-1-ylpropan-2-yl)-8-pyrrolidin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 174240638 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N-(1-piperazin-1-ylpropan-2-yl)-8-pyrrolidin-1-ylquinazolin-4-amine |
| SMILES | CC(CN1CCNCC1)Nc1ncnc2c(N3CCCC3)cccc12 |
| InChI | InChI=1S/C19H28N6/c1-15(13-24-11-7-20-8-12-24)23-19-16-5-4-6-17(18(16)21-14-22-19)25-9-2-3-10-25/h4-6,14-15,20H,2-3,7-13H2,1H3,(H,21,22,23) |
| InChIKey | IKTMJWBCEQLAKD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |