C29H24N4O6S — CID 174241336
benzenesulfonic acid;4-[[5-[(3R)-3-hydroxy-3-methyl-2-oxoindol-1-yl]-3-pyridinyl]methyl]-2H-phthalazin-1-one (PubChem CID 174241336) has the molecular formula C29H24N4O6S and a molecular weight of 556.60 g/mol. Its IUPAC name is benzenesulfonic acid;4-[[5-[(3R)-3-hydroxy-3-methyl-2-oxoindol-1-yl]-3-pyridinyl]methyl]-2H-phthalazin-1-one.
| Compound Name | benzenesulfonic acid;4-[[5-[(3R)-3-hydroxy-3-methyl-2-oxoindol-1-yl]-3-pyridinyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 174241336 |
| Molecular Formula | C29H24N4O6S |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | benzenesulfonic acid;4-[[5-[(3R)-3-hydroxy-3-methyl-2-oxoindol-1-yl]-3-pyridinyl]methyl]-2H-phthalazin-1-one |
| SMILES | C[C@]1(O)C(=O)N(c2cncc(Cc3n[nH]c(=O)c4ccccc34)c2)c2ccccc21.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O3.C6H6O3S/c1-23(30)18-8-4-5-9-20(18)27(22(23)29)15-10-14(12-24-13-15)11-19-16-6-2-3-7-17(16)21(28)26-25-19;7-10(8,9)6-4-2-1-3-5-6/h2-10,12-13,30H,11H2,1H3,(H,26,28);1-5H,(H,7,8,9)/t23-;/m1./s1 |
| InChIKey | AOSSEMKWCYWLMC-GNAFDRTKSA-N |
| XLogP | 3.73 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|