C41H20F7N3 — CID 174244254
2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174244254) has the molecular formula C41H20F7N3 and a molecular weight of 687.62 g/mol. Its IUPAC name is 2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174244254 |
| Molecular Formula | C41H20F7N3 |
| Molecular Weight | 687.62 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | 2-[6-[3-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)phenyl]naphthalen-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1c(F)c(F)c2c(-c3cccc(-c4ccc5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc5c4)c3)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C41H20F7N3/c42-32-29(30-31(34(44)36(32)46)35(45)38(48)37(47)33(30)43)27-13-7-12-23(19-27)24-14-15-26-20-28(17-16-25(26)18-24)41-50-39(21-8-3-1-4-9-21)49-40(51-41)22-10-5-2-6-11-22/h1-20H |
| InChIKey | RAKTXNLSUSAMCA-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.62 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|