C26H17F5N4O4 — CID 174246598
benzyl 4-(8-oxo-5,6-dihydro-1,7-naphthyridin-7-yl)-5-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]-1,3-oxazole-2-carboxylate (PubChem CID 174246598) has the molecular formula C26H17F5N4O4 and a molecular weight of 544.44 g/mol. Its IUPAC name is benzyl 4-(8-oxo-5,6-dihydro-1,7-naphthyridin-7-yl)-5-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]-1,3-oxazole-2-carboxylate.
| Compound Name | benzyl 4-(8-oxo-5,6-dihydro-1,7-naphthyridin-7-yl)-5-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 174246598 |
| Molecular Formula | C26H17F5N4O4 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | benzyl 4-(8-oxo-5,6-dihydro-1,7-naphthyridin-7-yl)-5-[6-(1,1,2,2,2-pentafluoroethyl)-3-pyridinyl]-1,3-oxazole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1nc(N2CCc3cccnc3C2=O)c(-c2ccc(C(F)(F)C(F)(F)F)nc2)o1 |
| InChI | InChI=1S/C26H17F5N4O4/c27-25(28,26(29,30)31)18-9-8-17(13-33-18)20-21(35-12-10-16-7-4-11-32-19(16)23(35)36)34-22(39-20)24(37)38-14-15-5-2-1-3-6-15/h1-9,11,13H,10,12,14H2 |
| InChIKey | JYAOCQSWDXSCBJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 98.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|