C29H25N3O4 — CID 122205281
dibenzyl 2-(1-pyrimidin-2-yl-2,3-dihydroindol-7-yl)propanedioate (PubChem CID 122205281) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is dibenzyl 2-(1-pyrimidin-2-yl-2,3-dihydroindol-7-yl)propanedioate.
| Compound Name | dibenzyl 2-(1-pyrimidin-2-yl-2,3-dihydroindol-7-yl)propanedioate |
|---|---|
| PubChem CID | 122205281 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | dibenzyl 2-(1-pyrimidin-2-yl-2,3-dihydroindol-7-yl)propanedioate |
| SMILES | O=C(OCc1ccccc1)C(C(=O)OCc1ccccc1)c1cccc2c1N(c1ncccn1)CC2 |
| InChI | InChI=1S/C29H25N3O4/c33-27(35-19-21-9-3-1-4-10-21)25(28(34)36-20-22-11-5-2-6-12-22)24-14-7-13-23-15-18-32(26(23)24)29-30-16-8-17-31-29/h1-14,16-17,25H,15,18-20H2 |
| InChIKey | YOYDQPHVXYLMAP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|