C22H19NO3 — CID 132574243
benzyl (E,2R)-4-phenyl-2-pyridin-2-yloxybut-3-enoate (PubChem CID 132574243) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is benzyl (E,2R)-4-phenyl-2-pyridin-2-yloxybut-3-enoate.
| Compound Name | benzyl (E,2R)-4-phenyl-2-pyridin-2-yloxybut-3-enoate |
|---|---|
| PubChem CID | 132574243 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | benzyl (E,2R)-4-phenyl-2-pyridin-2-yloxybut-3-enoate |
| SMILES | O=C(OCc1ccccc1)[C@@H](/C=C/c1ccccc1)Oc1ccccn1 |
| InChI | InChI=1S/C22H19NO3/c24-22(25-17-19-11-5-2-6-12-19)20(26-21-13-7-8-16-23-21)15-14-18-9-3-1-4-10-18/h1-16,20H,17H2/b15-14+/t20-/m1/s1 |
| InChIKey | JLPHWWSHRQYTQO-DAMWEWLOSA-N |
| XLogP | 4.29 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |