C29H31NO2 — CID 58622798
benzyl (E,2S)-5-phenyl-3-[[(1R)-1-phenylethyl]amino]-2-prop-2-enylpent-4-enoate (PubChem CID 58622798) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is benzyl (E,2S)-5-phenyl-3-[[(1R)-1-phenylethyl]amino]-2-prop-2-enylpent-4-enoate.
| Compound Name | benzyl (E,2S)-5-phenyl-3-[[(1R)-1-phenylethyl]amino]-2-prop-2-enylpent-4-enoate |
|---|---|
| PubChem CID | 58622798 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | benzyl (E,2S)-5-phenyl-3-[[(1R)-1-phenylethyl]amino]-2-prop-2-enylpent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OCc1ccccc1)C(/C=C/c1ccccc1)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H31NO2/c1-3-13-27(29(31)32-22-25-16-9-5-10-17-25)28(21-20-24-14-7-4-8-15-24)30-23(2)26-18-11-6-12-19-26/h3-12,14-21,23,27-28,30H,1,13,22H2,2H3/b21-20+/t23-,27+,28?/m1/s1 |
| InChIKey | SQMDXAOVXWKICJ-LQNIZXBXSA-N |
| XLogP | 6.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|